About [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate
[2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 2619216) has the molecular formula C13H12Cl2FNO3
and a molecular weight of 320.15 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| PubChem CID | 2619216 |
| Molecular Formula | C13H12Cl2FNO3 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@]1(C(=O)OCC(=O)Nc2ccccc2F)CC1(Cl)Cl |
| InChI | InChI=1S/C13H12Cl2FNO3/c1-12(7-13(12,14)15)11(19)20-6-10(18)17-9-5-3-2-4-8(9)16/h2-5H,6-7H2,1H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | WEJWDMQWHLBMNR-GFCCVEGCSA-N |
| XLogP | 2.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate?
The IUPAC name of [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (CID 2619216) is [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
What is the SMILES notation for [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate?
The canonical SMILES for [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate is C[C@]1(C(=O)OCC(=O)Nc2ccccc2F)CC1(Cl)Cl.
What is the InChIKey of [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate?
The InChIKey is WEJWDMQWHLBMNR-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H12Cl2FNO3/c1-12(7-13(12,14)15)11(19)20-6-10(18)17-9-5-3-2-4-8(9)16/h2-5H,6-7H2,1H3,(H,17,18)/t12-/m1/s1.
What are the key properties of [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate?
[2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate has a molecular weight of 320.15 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-fluoroanilino)-2-oxoethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate is sourced from PubChem (CID 2619216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).