C18H20O4 — CID 26195381
2,3,5,7-tetramethoxy-9,10-dihydrophenanthrene (PubChem CID 26195381) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2,3,5,7-tetramethoxy-9,10-dihydrophenanthrene.
| Compound Name | 2,3,5,7-tetramethoxy-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 26195381 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2,3,5,7-tetramethoxy-9,10-dihydrophenanthrene |
| SMILES | COc1cc2c(c(OC)c1)-c1cc(OC)c(OC)cc1CC2 |
| InChI | InChI=1S/C18H20O4/c1-19-13-7-12-6-5-11-8-15(20-2)16(21-3)10-14(11)18(12)17(9-13)22-4/h7-10H,5-6H2,1-4H3 |
| InChIKey | IQOUQPBWTJSPDL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |