About butane-2,3-diol
butane-2,3-diol (PubChem CID 262) has the molecular formula C4H10O2
and a molecular weight of 90.12 g/mol. Its IUPAC name is butane-2,3-diol.
Molecular Properties
| Compound Name | butane-2,3-diol |
| PubChem CID | 262 |
| Molecular Formula | C4H10O2 |
| Molecular Weight | 90.12 g/mol |
| Exact Mass | 90.07 |
| IUPAC Name | butane-2,3-diol |
| SMILES | CC(O)C(C)O |
| InChI | InChI=1S/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3 |
| InChIKey | OWBTYPJTUOEWEK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.12 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-2,3-diol?
The IUPAC name of butane-2,3-diol (CID 262) is butane-2,3-diol.
What is the SMILES notation for butane-2,3-diol?
The canonical SMILES for butane-2,3-diol is CC(O)C(C)O.
What is the InChIKey of butane-2,3-diol?
The InChIKey is OWBTYPJTUOEWEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3.
What are the key properties of butane-2,3-diol?
butane-2,3-diol has a molecular weight of 90.12 g/mol, XLogP of -0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane-2,3-diol is sourced from PubChem (CID 262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).