C19H18ClFN2O3S — CID 26204807
(E)-1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 26204807) has the molecular formula C19H18ClFN2O3S and a molecular weight of 408.88 g/mol. Its IUPAC name is (E)-1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 26204807 |
| Molecular Formula | C19H18ClFN2O3S |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | (E)-1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(F)cc1)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H18ClFN2O3S/c20-16-2-1-3-18(14-16)27(25,26)23-12-10-22(11-13-23)19(24)9-6-15-4-7-17(21)8-5-15/h1-9,14H,10-13H2/b9-6+ |
| InChIKey | AVVCGMNDLJSEIR-RMKNXTFCSA-N |
| XLogP | 3.03 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|