About N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine
N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 2620735) has the molecular formula C17H22N2O2S
and a molecular weight of 318.44 g/mol. Its IUPAC name is N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| PubChem CID | 2620735 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2csc(NC3CCCCC3)n2)c(OC)c1 |
| InChI | InChI=1S/C17H22N2O2S/c1-20-13-8-9-14(16(10-13)21-2)15-11-22-17(19-15)18-12-6-4-3-5-7-12/h8-12H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | XXGPQIXEHPQDPA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine?
The IUPAC name of N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine (CID 2620735) is N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine.
What is the SMILES notation for N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine?
The canonical SMILES for N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine is COc1ccc(-c2csc(NC3CCCCC3)n2)c(OC)c1.
What is the InChIKey of N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine?
The InChIKey is XXGPQIXEHPQDPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O2S/c1-20-13-8-9-14(16(10-13)21-2)15-11-22-17(19-15)18-12-6-4-3-5-7-12/h8-12H,3-7H2,1-2H3,(H,18,19).
What are the key properties of N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine?
N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine has a molecular weight of 318.44 g/mol, XLogP of 4.57, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 2620735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).