C27H33N3O2 — CID 26222784
1-benzyl-8-(2,3-dihydro-1H-inden-2-yl)-3-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26222784) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 1-benzyl-8-(2,3-dihydro-1H-inden-2-yl)-3-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-8-(2,3-dihydro-1H-inden-2-yl)-3-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26222784 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 1-benzyl-8-(2,3-dihydro-1H-inden-2-yl)-3-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)CN1C(=O)N(Cc2ccccc2)C2(CCN(C3Cc4ccccc4C3)CC2)C1=O |
| InChI | InChI=1S/C27H33N3O2/c1-20(2)18-29-25(31)27(30(26(29)32)19-21-8-4-3-5-9-21)12-14-28(15-13-27)24-16-22-10-6-7-11-23(22)17-24/h3-11,20,24H,12-19H2,1-2H3 |
| InChIKey | KQANJXJWFGPTRS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|