C18H30N4O2 — CID 26222892
N-(2-methoxyethyl)-1-(3-methylbutyl)-5-prop-2-enyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 26222892) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-(3-methylbutyl)-5-prop-2-enyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-(3-methylbutyl)-5-prop-2-enyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 26222892 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N-(2-methoxyethyl)-1-(3-methylbutyl)-5-prop-2-enyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | C=CCN1CCc2c(c(C(=O)NCCOC)nn2CCC(C)C)C1 |
| InChI | InChI=1S/C18H30N4O2/c1-5-9-21-10-7-16-15(13-21)17(18(23)19-8-12-24-4)20-22(16)11-6-14(2)3/h5,14H,1,6-13H2,2-4H3,(H,19,23) |
| InChIKey | WOZFBXPEFRVKMO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|