About ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate
ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 2622537) has the molecular formula C12H18N2O4
and a molecular weight of 254.29 g/mol. Its IUPAC name is ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| PubChem CID | 2622537 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C12H18N2O4/c1-2-18-9(15)8-14-10(16)12(13-11(14)17)6-4-3-5-7-12/h2-8H2,1H3,(H,13,17) |
| InChIKey | FFFXKVOTLKODRY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate?
The IUPAC name of ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (CID 2622537) is ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
What is the SMILES notation for ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate?
The canonical SMILES for ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate is CCOC(=O)CN1C(=O)NC2(CCCCC2)C1=O.
What is the InChIKey of ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate?
The InChIKey is FFFXKVOTLKODRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4/c1-2-18-9(15)8-14-10(16)12(13-11(14)17)6-4-3-5-7-12/h2-8H2,1H3,(H,13,17).
What are the key properties of ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate?
ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate has a molecular weight of 254.29 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate is sourced from PubChem (CID 2622537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).