C20H13N3O2S — CID 2622592
1-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)benzo[f]chromen-3-one (PubChem CID 2622592) has the molecular formula C20H13N3O2S and a molecular weight of 359.41 g/mol. Its IUPAC name is 1-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)benzo[f]chromen-3-one.
| Compound Name | 1-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 2622592 |
| Molecular Formula | C20H13N3O2S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 1-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)benzo[f]chromen-3-one |
| SMILES | O=c1cc(CSc2nnc3ccccn23)c2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C20H13N3O2S/c24-18-11-14(12-26-20-22-21-17-7-3-4-10-23(17)20)19-15-6-2-1-5-13(15)8-9-16(19)25-18/h1-11H,12H2 |
| InChIKey | BJRKXWNSYJPBRP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|