C26H32N6O3 — CID 26228874
1-[2-(4-methoxyphenyl)ethyl]-N,N-dimethyl-5-(4,5,6,7-tetrahydro-1H-indazole-3-carbonyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 26228874) has the molecular formula C26H32N6O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-N,N-dimethyl-5-(4,5,6,7-tetrahydro-1H-indazole-3-carbonyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-N,N-dimethyl-5-(4,5,6,7-tetrahydro-1H-indazole-3-carbonyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 26228874 |
| Molecular Formula | C26H32N6O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-N,N-dimethyl-5-(4,5,6,7-tetrahydro-1H-indazole-3-carbonyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | COc1ccc(CCn2nc(C(=O)N(C)C)c3c2CCN(C(=O)c2n[nH]c4c2CCCC4)C3)cc1 |
| InChI | InChI=1S/C26H32N6O3/c1-30(2)25(33)24-20-16-31(26(34)23-19-6-4-5-7-21(19)27-28-23)14-13-22(20)32(29-24)15-12-17-8-10-18(35-3)11-9-17/h8-11H,4-7,12-16H2,1-3H3,(H,27,28) |
| InChIKey | USZLQFXNRQPDRA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |