C20H32N4O — CID 26231873
(5R)-5-(cycloheptylamino)-N,N-dimethyl-1-prop-2-enyl-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 26231873) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is (5R)-5-(cycloheptylamino)-N,N-dimethyl-1-prop-2-enyl-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | (5R)-5-(cycloheptylamino)-N,N-dimethyl-1-prop-2-enyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 26231873 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (5R)-5-(cycloheptylamino)-N,N-dimethyl-1-prop-2-enyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | C=CCn1nc(C(=O)N(C)C)c2c1CC[C@@H](NC1CCCCCC1)C2 |
| InChI | InChI=1S/C20H32N4O/c1-4-13-24-18-12-11-16(21-15-9-7-5-6-8-10-15)14-17(18)19(22-24)20(25)23(2)3/h4,15-16,21H,1,5-14H2,2-3H3/t16-/m1/s1 |
| InChIKey | ZQXUUNVSAGDTIS-MRXNPFEDSA-N |
| XLogP | 2.94 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|