C26H29N5O2S — CID 26233358
1-benzyl-3-(3-pyridin-3-ylpropyl)-8-(1,3-thiazol-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26233358) has the molecular formula C26H29N5O2S and a molecular weight of 475.62 g/mol. Its IUPAC name is 1-benzyl-3-(3-pyridin-3-ylpropyl)-8-(1,3-thiazol-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-benzyl-3-(3-pyridin-3-ylpropyl)-8-(1,3-thiazol-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26233358 |
| Molecular Formula | C26H29N5O2S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 1-benzyl-3-(3-pyridin-3-ylpropyl)-8-(1,3-thiazol-2-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1N(CCCc2cccnc2)C(=O)C2(CCN(Cc3nccs3)CC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H29N5O2S/c32-24-26(10-15-29(16-11-26)20-23-28-13-17-34-23)31(19-22-6-2-1-3-7-22)25(33)30(24)14-5-9-21-8-4-12-27-18-21/h1-4,6-8,12-13,17-18H,5,9-11,14-16,19-20H2 |
| InChIKey | OHNMUAFRUVOLPL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|