C26H31N5O3 — CID 26233538
2-[1-ethyl-8-[(9-ethylcarbazol-3-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 26233538) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-[1-ethyl-8-[(9-ethylcarbazol-3-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | 2-[1-ethyl-8-[(9-ethylcarbazol-3-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 26233538 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 2-[1-ethyl-8-[(9-ethylcarbazol-3-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CCN1C(=O)N(CC(N)=O)C(=O)C12CCN(Cc1ccc3c(c1)c1ccccc1n3CC)CC2 |
| InChI | InChI=1S/C26H31N5O3/c1-3-29-21-8-6-5-7-19(21)20-15-18(9-10-22(20)29)16-28-13-11-26(12-14-28)24(33)30(17-23(27)32)25(34)31(26)4-2/h5-10,15H,3-4,11-14,16-17H2,1-2H3,(H2,27,32) |
| InChIKey | KEDCEJPFUOGXGU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 91.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|