C29H39N3O3 — CID 26234054
3-(2,3-dihydro-1H-inden-2-yl)-8-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-1-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26234054) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-2-yl)-8-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-1-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(2,3-dihydro-1H-inden-2-yl)-8-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-1-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26234054 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-2-yl)-8-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-1-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCN1C(=O)N(C2Cc3ccccc3C2)C(=O)C12CCN(CC1=CC[C@H]3C[C@@H]1C3(C)C)CC2 |
| InChI | InChI=1S/C29H39N3O3/c1-28(2)23-9-8-22(25(28)18-23)19-30-12-10-29(11-13-30)26(33)32(27(34)31(29)14-15-35-3)24-16-20-6-4-5-7-21(20)17-24/h4-8,23-25H,9-19H2,1-3H3/t23-,25-/m0/s1 |
| InChIKey | YLFHBFBLJBSSSJ-ZCYQVOJMSA-N |
| XLogP | 3.89 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|