5-amino-2-pentoxybenzoic acid

C12H17NO3 — CID 26238

IUPAC5-amino-2-pentoxybenzoic acid
SMILESCCCCCOc1ccc(N)cc1C(=O)O
InChIInChI=1S/C12H17NO3/c1-2-3-4-7-16-11-6-5-9(13)8-10(11)12(14)15/h5-6,8H,2-4,7,13H2,1H3,(H,14,15)
InChIKeyNYASYUYEILXZAS-UHFFFAOYSA-N
MW223.27 g/mol
LogP2.54
Rot. Bonds6

About 5-amino-2-pentoxybenzoic acid

5-amino-2-pentoxybenzoic acid (PubChem CID 26238) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 5-amino-2-pentoxybenzoic acid.

Molecular Properties

Compound Name5-amino-2-pentoxybenzoic acid
PubChem CID26238
Molecular FormulaC12H17NO3
Molecular Weight223.27 g/mol
Exact Mass223.12
IUPAC Name5-amino-2-pentoxybenzoic acid
SMILESCCCCCOc1ccc(N)cc1C(=O)O
InChIInChI=1S/C12H17NO3/c1-2-3-4-7-16-11-6-5-9(13)8-10(11)12(14)15/h5-6,8H,2-4,7,13H2,1H3,(H,14,15)
InChIKeyNYASYUYEILXZAS-UHFFFAOYSA-N
XLogP2.54
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.27
LogP ≤ 52.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 5-amino-2-pentoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-2-pentoxybenzoic acid?
The IUPAC name of 5-amino-2-pentoxybenzoic acid (CID 26238) is 5-amino-2-pentoxybenzoic acid.
What is the SMILES notation for 5-amino-2-pentoxybenzoic acid?
The canonical SMILES for 5-amino-2-pentoxybenzoic acid is CCCCCOc1ccc(N)cc1C(=O)O.
What is the InChIKey of 5-amino-2-pentoxybenzoic acid?
The InChIKey is NYASYUYEILXZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-2-3-4-7-16-11-6-5-9(13)8-10(11)12(14)15/h5-6,8H,2-4,7,13H2,1H3,(H,14,15).
What are the key properties of 5-amino-2-pentoxybenzoic acid?
5-amino-2-pentoxybenzoic acid has a molecular weight of 223.27 g/mol, XLogP of 2.54, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-pentoxybenzoic acid is sourced from PubChem (CID 26238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).