C18H18ClNO3 — CID 26239058
(2R)-2-(4-chlorophenoxy)-N-(3-prop-2-enoxyphenyl)propanamide (PubChem CID 26239058) has the molecular formula C18H18ClNO3 and a molecular weight of 331.80 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenoxy)-N-(3-prop-2-enoxyphenyl)propanamide.
| Compound Name | (2R)-2-(4-chlorophenoxy)-N-(3-prop-2-enoxyphenyl)propanamide |
|---|---|
| PubChem CID | 26239058 |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (2R)-2-(4-chlorophenoxy)-N-(3-prop-2-enoxyphenyl)propanamide |
| SMILES | C=CCOc1cccc(NC(=O)[C@@H](C)Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H18ClNO3/c1-3-11-22-17-6-4-5-15(12-17)20-18(21)13(2)23-16-9-7-14(19)8-10-16/h3-10,12-13H,1,11H2,2H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | DNIWFUMKEFUBIB-CYBMUJFWSA-N |
| XLogP | 4.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|