C19H20N2O4 — CID 26243278
(E)-N-(5-acetamido-2-methoxyphenyl)-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 26243278) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (E)-N-(5-acetamido-2-methoxyphenyl)-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-acetamido-2-methoxyphenyl)-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26243278 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (E)-N-(5-acetamido-2-methoxyphenyl)-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1/C=C/C(=O)Nc1cc(NC(C)=O)ccc1OC |
| InChI | InChI=1S/C19H20N2O4/c1-13(22)20-15-9-10-18(25-3)16(12-15)21-19(23)11-8-14-6-4-5-7-17(14)24-2/h4-12H,1-3H3,(H,20,22)(H,21,23)/b11-8+ |
| InChIKey | POSCXYSQCKCRRR-DHZHZOJOSA-N |
| XLogP | 3.31 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|