C18H21N3O2S — CID 26243376
N-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 26243376) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 26243376 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CC(C)(C)c1csc(NC(=O)c2ccc(N3CCCC3=O)cc2)n1 |
| InChI | InChI=1S/C18H21N3O2S/c1-18(2,3)14-11-24-17(19-14)20-16(23)12-6-8-13(9-7-12)21-10-4-5-15(21)22/h6-9,11H,4-5,10H2,1-3H3,(H,19,20,23) |
| InChIKey | JAVODGIBGIEWRH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |