About [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate
[(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate (PubChem CID 2624869) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate.
Molecular Properties
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate |
| PubChem CID | 2624869 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(O)cc1)C(N)=O |
| InChI | InChI=1S/C10H11NO4/c1-6(9(11)13)15-10(14)7-2-4-8(12)5-3-7/h2-6,12H,1H3,(H2,11,13)/t6-/m0/s1 |
| InChIKey | OXWOUUKCJICYQX-LURJTMIESA-N |
| XLogP | 0.42 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate?
The IUPAC name of [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate (CID 2624869) is [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate.
What is the SMILES notation for [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate?
The canonical SMILES for [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate is C[C@H](OC(=O)c1ccc(O)cc1)C(N)=O.
What is the InChIKey of [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate?
The InChIKey is OXWOUUKCJICYQX-LURJTMIESA-N. The full InChI is InChI=1S/C10H11NO4/c1-6(9(11)13)15-10(14)7-2-4-8(12)5-3-7/h2-6,12H,1H3,(H2,11,13)/t6-/m0/s1.
What are the key properties of [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate?
[(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate has a molecular weight of 209.20 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-amino-1-oxopropan-2-yl] 4-hydroxybenzoate is sourced from PubChem (CID 2624869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).