About N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine
N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine (PubChem CID 26248854) has the molecular formula C11H12N2S
and a molecular weight of 204.30 g/mol. Its IUPAC name is N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine |
| PubChem CID | 26248854 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine |
| SMILES | CNCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H12N2S/c1-12-7-10-8-14-11(13-10)9-5-3-2-4-6-9/h2-6,8,12H,7H2,1H3 |
| InChIKey | UGRXAOUDHZOHPF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine?
The IUPAC name of N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine (CID 26248854) is N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine.
What is the SMILES notation for N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine?
The canonical SMILES for N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine is CNCc1csc(-c2ccccc2)n1.
What is the InChIKey of N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine?
The InChIKey is UGRXAOUDHZOHPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S/c1-12-7-10-8-14-11(13-10)9-5-3-2-4-6-9/h2-6,8,12H,7H2,1H3.
What are the key properties of N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine?
N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine has a molecular weight of 204.30 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine is sourced from PubChem (CID 26248854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).