C19H21NO4 — CID 2624914
[(2R)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 4-hydroxybenzoate (PubChem CID 2624914) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 4-hydroxybenzoate.
| Compound Name | [(2R)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 2624914 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | [(2R)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 4-hydroxybenzoate |
| SMILES | Cc1cc(C)c(NC(=O)[C@@H](C)OC(=O)c2ccc(O)cc2)c(C)c1 |
| InChI | InChI=1S/C19H21NO4/c1-11-9-12(2)17(13(3)10-11)20-18(22)14(4)24-19(23)15-5-7-16(21)8-6-15/h5-10,14,21H,1-4H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | CIQZNLHOXXOPAO-CQSZACIVSA-N |
| XLogP | 3.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |