About [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate
[(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate (PubChem CID 26263682) has the molecular formula C9H10Cl2N2O3
and a molecular weight of 265.10 g/mol. Its IUPAC name is [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate |
| PubChem CID | 26263682 |
| Molecular Formula | C9H10Cl2N2O3 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1noc(N)c1C(=O)OC[C@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C9H10Cl2N2O3/c1-4-6(7(12)16-13-4)8(14)15-3-5-2-9(5,10)11/h5H,2-3,12H2,1H3/t5-/m1/s1 |
| InChIKey | UMBRXZGWKIYJCR-RXMQYKEDSA-N |
| XLogP | 1.92 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate?
The IUPAC name of [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate (CID 26263682) is [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate is Cc1noc(N)c1C(=O)OC[C@H]1CC1(Cl)Cl.
What is the InChIKey of [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate?
The InChIKey is UMBRXZGWKIYJCR-RXMQYKEDSA-N. The full InChI is InChI=1S/C9H10Cl2N2O3/c1-4-6(7(12)16-13-4)8(14)15-3-5-2-9(5,10)11/h5H,2-3,12H2,1H3/t5-/m1/s1.
What are the key properties of [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate?
[(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate has a molecular weight of 265.10 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2,2-dichlorocyclopropyl]methyl 5-amino-3-methyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 26263682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).