C18H28N2O4S — CID 26265845
N-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)-3-methylbutanamide (PubChem CID 26265845) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)-3-methylbutanamide.
| Compound Name | N-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 26265845 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)-3-methylbutanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)CC(C)C |
| InChI | InChI=1S/C18H28N2O4S/c1-4-24-17-9-8-15(13-16(17)19-18(21)12-14(2)3)25(22,23)20-10-6-5-7-11-20/h8-9,13-14H,4-7,10-12H2,1-3H3,(H,19,21) |
| InChIKey | PPEJEXWXOMNQCX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |