About 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide
2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide (PubChem CID 26267572) has the molecular formula C14H12BrF2NO4S2
and a molecular weight of 440.29 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide |
| PubChem CID | 26267572 |
| Molecular Formula | C14H12BrF2NO4S2 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 438.94 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1NS(=O)(=O)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C14H12BrF2NO4S2/c1-8-3-4-10(23(2,19)20)7-13(8)18-24(21,22)14-11(15)5-9(16)6-12(14)17/h3-7,18H,1-2H3 |
| InChIKey | HBPHJRKGSCJFCL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide?
The IUPAC name of 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide (CID 26267572) is 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide.
What is the SMILES notation for 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide?
The canonical SMILES for 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide is Cc1ccc(S(C)(=O)=O)cc1NS(=O)(=O)c1c(F)cc(F)cc1Br.
What is the InChIKey of 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide?
The InChIKey is HBPHJRKGSCJFCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrF2NO4S2/c1-8-3-4-10(23(2,19)20)7-13(8)18-24(21,22)14-11(15)5-9(16)6-12(14)17/h3-7,18H,1-2H3.
What are the key properties of 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide?
2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide has a molecular weight of 440.29 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,6-difluoro-N-(2-methyl-5-methylsulfonylphenyl)benzenesulfonamide is sourced from PubChem (CID 26267572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).