About [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate
[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate (PubChem CID 2627247) has the molecular formula C21H20N2O5S
and a molecular weight of 412.47 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate |
| PubChem CID | 2627247 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate |
| SMILES | N#Cc1cccc(C(=O)OCC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C21H20N2O5S/c22-14-16-5-4-6-18(13-16)21(25)28-15-20(24)17-7-9-19(10-8-17)29(26,27)23-11-2-1-3-12-23/h4-10,13H,1-3,11-12,15H2 |
| InChIKey | FWEFAHZPWGPYNH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate?
The IUPAC name of [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate (CID 2627247) is [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate.
What is the SMILES notation for [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate?
The canonical SMILES for [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate is N#Cc1cccc(C(=O)OCC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)c1.
What is the InChIKey of [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate?
The InChIKey is FWEFAHZPWGPYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O5S/c22-14-16-5-4-6-18(13-16)21(25)28-15-20(24)17-7-9-19(10-8-17)29(26,27)23-11-2-1-3-12-23/h4-10,13H,1-3,11-12,15H2.
What are the key properties of [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate?
[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate has a molecular weight of 412.47 g/mol, XLogP of 2.77, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl] 3-cyanobenzoate is sourced from PubChem (CID 2627247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).