C16H14N2O8 — CID 2627473
[(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate (PubChem CID 2627473) has the molecular formula C16H14N2O8 and a molecular weight of 362.29 g/mol. Its IUPAC name is [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate.
| Compound Name | [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2627473 |
| Molecular Formula | C16H14N2O8 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | [(2S)-1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc([N+](=O)[O-])o1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14N2O8/c1-9(25-16(20)12-4-5-14(26-12)18(21)22)15(19)17-7-10-2-3-11-13(6-10)24-8-23-11/h2-6,9H,7-8H2,1H3,(H,17,19)/t9-/m0/s1 |
| InChIKey | ATMVYBJZONSFHI-VIFPVBQESA-N |
| XLogP | 1.78 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|