C27H31FN4O2 — CID 26275783
2-(4-fluorophenyl)-N-[3-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]propyl]acetamide (PubChem CID 26275783) has the molecular formula C27H31FN4O2 and a molecular weight of 462.57 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[3-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]propyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[3-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]propyl]acetamide |
|---|---|
| PubChem CID | 26275783 |
| Molecular Formula | C27H31FN4O2 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[3-[4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenoxy]propyl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)NCCCOc1ccc(CN2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C27H31FN4O2/c28-24-9-5-22(6-10-24)20-27(33)30-14-3-19-34-25-11-7-23(8-12-25)21-31-15-17-32(18-16-31)26-4-1-2-13-29-26/h1-2,4-13H,3,14-21H2,(H,30,33) |
| InChIKey | DILHXJBUAIZARL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|