C26H32FN5O2 — CID 26278942
[4-[(1R)-1-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone (PubChem CID 26278942) has the molecular formula C26H32FN5O2 and a molecular weight of 465.57 g/mol. Its IUPAC name is [4-[(1R)-1-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone.
| Compound Name | [4-[(1R)-1-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone |
|---|---|
| PubChem CID | 26278942 |
| Molecular Formula | C26H32FN5O2 |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | [4-[(1R)-1-[(1,3-dimethylpyrazol-4-yl)methyl-methylamino]-2-(4-fluorophenyl)ethyl]piperidin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanone |
| SMILES | Cc1nn(C)cc1CN(C)[C@H](Cc1ccc(F)cc1)C1CCN(C(=O)c2cc[n+]([O-])cc2)CC1 |
| InChI | InChI=1S/C26H32FN5O2/c1-19-23(18-30(3)28-19)17-29(2)25(16-20-4-6-24(27)7-5-20)21-8-12-31(13-9-21)26(33)22-10-14-32(34)15-11-22/h4-7,10-11,14-15,18,21,25H,8-9,12-13,16-17H2,1-3H3/t25-/m1/s1 |
| InChIKey | LCGKMMUJRPYJGK-RUZDIDTESA-N |
| XLogP | 3.10 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|