About 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one
4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one (PubChem CID 26280830) has the molecular formula C22H25ClN2O3
and a molecular weight of 400.91 g/mol. Its IUPAC name is 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one |
| PubChem CID | 26280830 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(CCCc2ccccc2)CCN1Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C22H25ClN2O3/c23-19-14-21-20(27-16-28-21)13-18(19)15-25-12-11-24(10-8-22(25)26)9-4-7-17-5-2-1-3-6-17/h1-3,5-6,13-14H,4,7-12,15-16H2 |
| InChIKey | QWDNKDXCUHUMMO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one?
The IUPAC name of 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one (CID 26280830) is 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one.
What is the SMILES notation for 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one?
The canonical SMILES for 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one is O=C1CCN(CCCc2ccccc2)CCN1Cc1cc2c(cc1Cl)OCO2.
What is the InChIKey of 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one?
The InChIKey is QWDNKDXCUHUMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25ClN2O3/c23-19-14-21-20(27-16-28-21)13-18(19)15-25-12-11-24(10-8-22(25)26)9-4-7-17-5-2-1-3-6-17/h1-3,5-6,13-14H,4,7-12,15-16H2.
What are the key properties of 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one?
4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one has a molecular weight of 400.91 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1-(3-phenylpropyl)-1,4-diazepan-5-one is sourced from PubChem (CID 26280830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).