C17H23N5O3S2 — CID 2628640
propan-2-yl (6R)-2-[[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 2628640) has the molecular formula C17H23N5O3S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is propan-2-yl (6R)-2-[[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl (6R)-2-[[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 2628640 |
| Molecular Formula | C17H23N5O3S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | propan-2-yl (6R)-2-[[2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(NC(=O)CSc2n[nH]c(N)n2)sc2c1CC[C@@H](C)C2 |
| InChI | InChI=1S/C17H23N5O3S2/c1-8(2)25-15(24)13-10-5-4-9(3)6-11(10)27-14(13)19-12(23)7-26-17-20-16(18)21-22-17/h8-9H,4-7H2,1-3H3,(H,19,23)(H3,18,20,21,22)/t9-/m1/s1 |
| InChIKey | XNQWJDYVBBZZDA-SECBINFHSA-N |
| XLogP | 2.87 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |