C19H15ClN4O — CID 26289954
4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-(4-cyanophenyl)benzamide (PubChem CID 26289954) has the molecular formula C19H15ClN4O and a molecular weight of 350.81 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-(4-cyanophenyl)benzamide.
| Compound Name | 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-(4-cyanophenyl)benzamide |
|---|---|
| PubChem CID | 26289954 |
| Molecular Formula | C19H15ClN4O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylpyrazol-1-yl)-N-(4-cyanophenyl)benzamide |
| SMILES | Cc1nn(-c2ccc(C(=O)Nc3ccc(C#N)cc3)cc2)c(C)c1Cl |
| InChI | InChI=1S/C19H15ClN4O/c1-12-18(20)13(2)24(23-12)17-9-5-15(6-10-17)19(25)22-16-7-3-14(11-21)4-8-16/h3-10H,1-2H3,(H,22,25) |
| InChIKey | WPVNATVVRSPWJS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |