C16H17ClN2 — CID 26291
6-(4-chlorophenyl)-1,2,3,4,5,6-hexahydro-2,5-benzodiazocine (PubChem CID 26291) has the molecular formula C16H17ClN2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-1,2,3,4,5,6-hexahydro-2,5-benzodiazocine.
| Compound Name | 6-(4-chlorophenyl)-1,2,3,4,5,6-hexahydro-2,5-benzodiazocine |
|---|---|
| PubChem CID | 26291 |
| Molecular Formula | C16H17ClN2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 6-(4-chlorophenyl)-1,2,3,4,5,6-hexahydro-2,5-benzodiazocine |
| SMILES | Clc1ccc(C2NCCNCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H17ClN2/c17-14-7-5-12(6-8-14)16-15-4-2-1-3-13(15)11-18-9-10-19-16/h1-8,16,18-19H,9-11H2 |
| InChIKey | BIRFBGKBJMZZJI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |