C17H19N5O2S2 — CID 26297793
(2R)-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 26297793) has the molecular formula C17H19N5O2S2 and a molecular weight of 389.51 g/mol. Its IUPAC name is (2R)-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | (2R)-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 26297793 |
| Molecular Formula | C17H19N5O2S2 |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (2R)-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | CCOc1ccccc1-n1nnnc1S[C@H](C)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C17H19N5O2S2/c1-3-24-15-9-5-4-8-14(15)22-17(19-20-21-22)26-12(2)16(23)18-11-13-7-6-10-25-13/h4-10,12H,3,11H2,1-2H3,(H,18,23)/t12-/m1/s1 |
| InChIKey | NDFRCAMOUYYQNX-GFCCVEGCSA-N |
| XLogP | 2.92 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |