C10H11ClN6OS — CID 2630257
(2S)-N-(5-chloro-2-pyridinyl)-2-(1-methyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 2630257) has the molecular formula C10H11ClN6OS and a molecular weight of 298.76 g/mol. Its IUPAC name is (2S)-N-(5-chloro-2-pyridinyl)-2-(1-methyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-(5-chloro-2-pyridinyl)-2-(1-methyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 2630257 |
| Molecular Formula | C10H11ClN6OS |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | (2S)-N-(5-chloro-2-pyridinyl)-2-(1-methyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1nnnn1C)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C10H11ClN6OS/c1-6(19-10-14-15-16-17(10)2)9(18)13-8-4-3-7(11)5-12-8/h3-6H,1-2H3,(H,12,13,18)/t6-/m0/s1 |
| InChIKey | TTZLYPFKVTUFOF-LURJTMIESA-N |
| XLogP | 1.38 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |