C20H17ClN2O6 — CID 2631098
[2-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloro-5-nitrobenzoate (PubChem CID 2631098) has the molecular formula C20H17ClN2O6 and a molecular weight of 416.82 g/mol. Its IUPAC name is [2-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 2631098 |
| Molecular Formula | C20H17ClN2O6 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | [2-[1-(furan-2-ylmethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloro-5-nitrobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cc([N+](=O)[O-])ccc2Cl)c(C)n1Cc1ccco1 |
| InChI | InChI=1S/C20H17ClN2O6/c1-12-8-16(13(2)22(12)10-15-4-3-7-28-15)19(24)11-29-20(25)17-9-14(23(26)27)5-6-18(17)21/h3-9H,10-11H2,1-2H3 |
| InChIKey | DDUKTAGITZXDBW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 104.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|