About (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate (PubChem CID 2631596) has the molecular formula C12H8N2O4S
and a molecular weight of 276.27 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate.
Molecular Properties
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate |
| PubChem CID | 2631596 |
| Molecular Formula | C12H8N2O4S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate |
| SMILES | O=C(OCc1cc(=O)n2ccsc2n1)c1ccco1 |
| InChI | InChI=1S/C12H8N2O4S/c15-10-6-8(13-12-14(10)3-5-19-12)7-18-11(16)9-2-1-4-17-9/h1-6H,7H2 |
| InChIKey | JIUDVJVPRTWODJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate?
The IUPAC name of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate (CID 2631596) is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate.
What is the SMILES notation for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate?
The canonical SMILES for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate is O=C(OCc1cc(=O)n2ccsc2n1)c1ccco1.
What is the InChIKey of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate?
The InChIKey is JIUDVJVPRTWODJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O4S/c15-10-6-8(13-12-14(10)3-5-19-12)7-18-11(16)9-2-1-4-17-9/h1-6H,7H2.
What are the key properties of (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate?
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate has a molecular weight of 276.27 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl furan-2-carboxylate is sourced from PubChem (CID 2631596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).