C11H16N6O2 — CID 26316752
6-N-(2-methoxyethyl)-5-N-(2-methylprop-2-enyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 26316752) has the molecular formula C11H16N6O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 6-N-(2-methoxyethyl)-5-N-(2-methylprop-2-enyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 6-N-(2-methoxyethyl)-5-N-(2-methylprop-2-enyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 26316752 |
| Molecular Formula | C11H16N6O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 6-N-(2-methoxyethyl)-5-N-(2-methylprop-2-enyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | C=C(C)CNc1nc2nonc2nc1NCCOC |
| InChI | InChI=1S/C11H16N6O2/c1-7(2)6-13-9-8(12-4-5-18-3)14-10-11(15-9)17-19-16-10/h1,4-6H2,2-3H3,(H,12,14,16)(H,13,15,17) |
| InChIKey | SFVAMUASNWTANW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|