C23H28FN3O3 — CID 26318793
3-[[2-(2-fluorophenyl)ethylamino]methyl]-5,6,7-trimethoxy-N,N-dimethylquinolin-2-amine (PubChem CID 26318793) has the molecular formula C23H28FN3O3 and a molecular weight of 413.49 g/mol. Its IUPAC name is 3-[[2-(2-fluorophenyl)ethylamino]methyl]-5,6,7-trimethoxy-N,N-dimethylquinolin-2-amine.
| Compound Name | 3-[[2-(2-fluorophenyl)ethylamino]methyl]-5,6,7-trimethoxy-N,N-dimethylquinolin-2-amine |
|---|---|
| PubChem CID | 26318793 |
| Molecular Formula | C23H28FN3O3 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 3-[[2-(2-fluorophenyl)ethylamino]methyl]-5,6,7-trimethoxy-N,N-dimethylquinolin-2-amine |
| SMILES | COc1cc2nc(N(C)C)c(CNCCc3ccccc3F)cc2c(OC)c1OC |
| InChI | InChI=1S/C23H28FN3O3/c1-27(2)23-16(14-25-11-10-15-8-6-7-9-18(15)24)12-17-19(26-23)13-20(28-3)22(30-5)21(17)29-4/h6-9,12-13,25H,10-11,14H2,1-5H3 |
| InChIKey | SCZVFBYRZHBQKZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|