C26H29FN4O2 — CID 26320376
(1S,5S,7S)-7-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-3-[(5-methylfuran-2-yl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one (PubChem CID 26320376) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is (1S,5S,7S)-7-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-3-[(5-methylfuran-2-yl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one.
| Compound Name | (1S,5S,7S)-7-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-3-[(5-methylfuran-2-yl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
|---|---|
| PubChem CID | 26320376 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (1S,5S,7S)-7-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-3-[(5-methylfuran-2-yl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
| SMILES | Cc1ccc(CN2C[C@@H]3C[C@@H](c4c(C)nn(-c5ccc(F)cc5)c4C)N4CCC[C@@]34C2=O)o1 |
| InChI | InChI=1S/C26H29FN4O2/c1-16-5-10-22(33-16)15-29-14-19-13-23(30-12-4-11-26(19,30)25(29)32)24-17(2)28-31(18(24)3)21-8-6-20(27)7-9-21/h5-10,19,23H,4,11-15H2,1-3H3/t19-,23-,26-/m0/s1 |
| InChIKey | YWVZMXCGZCOSIJ-CZZAQMAHSA-N |
| XLogP | 4.47 |
| TPSA | 54.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |