C23H25F3N4O5 — CID 26322102
9-methoxy-10-(3-oxopiperazine-1-carbonyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepin-7-one (PubChem CID 26322102) has the molecular formula C23H25F3N4O5 and a molecular weight of 494.47 g/mol. Its IUPAC name is 9-methoxy-10-(3-oxopiperazine-1-carbonyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepin-7-one.
| Compound Name | 9-methoxy-10-(3-oxopiperazine-1-carbonyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepin-7-one |
|---|---|
| PubChem CID | 26322102 |
| Molecular Formula | C23H25F3N4O5 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 9-methoxy-10-(3-oxopiperazine-1-carbonyl)-3-[[4-(trifluoromethoxy)phenyl]methyl]-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepin-7-one |
| SMILES | COc1cc(=O)n2c(c1C(=O)N1CCNC(=O)C1)CCN(Cc1ccc(OC(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C23H25F3N4O5/c1-34-18-12-20(32)30-11-10-28(13-15-2-4-16(5-3-15)35-23(24,25)26)8-6-17(30)21(18)22(33)29-9-7-27-19(31)14-29/h2-5,12H,6-11,13-14H2,1H3,(H,27,31) |
| InChIKey | OLNNPKQECBMFSO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |