C24H25FN2O3 — CID 26322313
N-[4-(2-fluorophenoxy)phenyl]-1-[(5-methylfuran-2-yl)methyl]piperidine-4-carboxamide (PubChem CID 26322313) has the molecular formula C24H25FN2O3 and a molecular weight of 408.47 g/mol. Its IUPAC name is N-[4-(2-fluorophenoxy)phenyl]-1-[(5-methylfuran-2-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[4-(2-fluorophenoxy)phenyl]-1-[(5-methylfuran-2-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26322313 |
| Molecular Formula | C24H25FN2O3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-[4-(2-fluorophenoxy)phenyl]-1-[(5-methylfuran-2-yl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(CN2CCC(C(=O)Nc3ccc(Oc4ccccc4F)cc3)CC2)o1 |
| InChI | InChI=1S/C24H25FN2O3/c1-17-6-9-21(29-17)16-27-14-12-18(13-15-27)24(28)26-19-7-10-20(11-8-19)30-23-5-3-2-4-22(23)25/h2-11,18H,12-16H2,1H3,(H,26,28) |
| InChIKey | JXUGOYMAFPHIOQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |