C18H21N5O2S2 — CID 26325196
5-(methoxymethyl)-N-(3-methylsulfanylpropyl)-1-(4-thiophen-2-ylpyrimidin-2-yl)pyrazole-4-carboxamide (PubChem CID 26325196) has the molecular formula C18H21N5O2S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-(3-methylsulfanylpropyl)-1-(4-thiophen-2-ylpyrimidin-2-yl)pyrazole-4-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-(3-methylsulfanylpropyl)-1-(4-thiophen-2-ylpyrimidin-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 26325196 |
| Molecular Formula | C18H21N5O2S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 5-(methoxymethyl)-N-(3-methylsulfanylpropyl)-1-(4-thiophen-2-ylpyrimidin-2-yl)pyrazole-4-carboxamide |
| SMILES | COCc1c(C(=O)NCCCSC)cnn1-c1nccc(-c2cccs2)n1 |
| InChI | InChI=1S/C18H21N5O2S2/c1-25-12-15-13(17(24)19-7-4-9-26-2)11-21-23(15)18-20-8-6-14(22-18)16-5-3-10-27-16/h3,5-6,8,10-11H,4,7,9,12H2,1-2H3,(H,19,24) |
| InChIKey | PLRUAVQKLNDEBG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|