C25H29N3O2 — CID 26325271
3-[1-(3,5-dimethyl-1H-indole-2-carbonyl)piperidin-4-yl]-N-phenylpropanamide (PubChem CID 26325271) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-[1-(3,5-dimethyl-1H-indole-2-carbonyl)piperidin-4-yl]-N-phenylpropanamide.
| Compound Name | 3-[1-(3,5-dimethyl-1H-indole-2-carbonyl)piperidin-4-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 26325271 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 3-[1-(3,5-dimethyl-1H-indole-2-carbonyl)piperidin-4-yl]-N-phenylpropanamide |
| SMILES | Cc1ccc2[nH]c(C(=O)N3CCC(CCC(=O)Nc4ccccc4)CC3)c(C)c2c1 |
| InChI | InChI=1S/C25H29N3O2/c1-17-8-10-22-21(16-17)18(2)24(27-22)25(30)28-14-12-19(13-15-28)9-11-23(29)26-20-6-4-3-5-7-20/h3-8,10,16,19,27H,9,11-15H2,1-2H3,(H,26,29) |
| InChIKey | SYEDVGHRGNXJJA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|