C16H19N5O3S2 — CID 2633205
2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide (PubChem CID 2633205) has the molecular formula C16H19N5O3S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide.
| Compound Name | 2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2633205 |
| Molecular Formula | C16H19N5O3S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[[5-(2-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
| SMILES | C=CCNC(=O)NC(=O)CSc1nnc(Nc2ccccc2OCC)s1 |
| InChI | InChI=1S/C16H19N5O3S2/c1-3-9-17-14(23)19-13(22)10-25-16-21-20-15(26-16)18-11-7-5-6-8-12(11)24-4-2/h3,5-8H,1,4,9-10H2,2H3,(H,18,20)(H2,17,19,22,23) |
| InChIKey | SOKSMZFKDUOUJE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|