C13H20N4O4 — CID 2633637
2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-(methylcarbamoyl)acetamide (PubChem CID 2633637) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-(methylcarbamoyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-(methylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2633637 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)-N-(methylcarbamoyl)acetamide |
| SMILES | CNC(=O)NC(=O)CN1C(=O)NC2(CCCCCC2)C1=O |
| InChI | InChI=1S/C13H20N4O4/c1-14-11(20)15-9(18)8-17-10(19)13(16-12(17)21)6-4-2-3-5-7-13/h2-8H2,1H3,(H,16,21)(H2,14,15,18,20) |
| InChIKey | FSAZVUOVKZWLLX-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|