About (2S,6R)-2,6-dimethylpiperidin-4-ol
(2S,6R)-2,6-dimethylpiperidin-4-ol (PubChem CID 26338440) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | (2S,6R)-2,6-dimethylpiperidin-4-ol |
| PubChem CID | 26338440 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (2S,6R)-2,6-dimethylpiperidin-4-ol |
| SMILES | C[C@@H]1CC(O)C[C@H](C)N1 |
| InChI | InChI=1S/C7H15NO/c1-5-3-7(9)4-6(2)8-5/h5-9H,3-4H2,1-2H3/t5-,6+,7? |
| InChIKey | IEMVEYRBXJCBBQ-MEKDEQNOSA-N |
| XLogP | 0.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,6R)-2,6-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-2,6-dimethylpiperidin-4-ol?
The IUPAC name of (2S,6R)-2,6-dimethylpiperidin-4-ol (CID 26338440) is (2S,6R)-2,6-dimethylpiperidin-4-ol.
What is the SMILES notation for (2S,6R)-2,6-dimethylpiperidin-4-ol?
The canonical SMILES for (2S,6R)-2,6-dimethylpiperidin-4-ol is C[C@@H]1CC(O)C[C@H](C)N1.
What is the InChIKey of (2S,6R)-2,6-dimethylpiperidin-4-ol?
The InChIKey is IEMVEYRBXJCBBQ-MEKDEQNOSA-N. The full InChI is InChI=1S/C7H15NO/c1-5-3-7(9)4-6(2)8-5/h5-9H,3-4H2,1-2H3/t5-,6+,7?.
What are the key properties of (2S,6R)-2,6-dimethylpiperidin-4-ol?
(2S,6R)-2,6-dimethylpiperidin-4-ol has a molecular weight of 129.20 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-2,6-dimethylpiperidin-4-ol is sourced from PubChem (CID 26338440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).