C23H38N6O3 — CID 26339587
ethyl 4-[3-[2-(cyclohexanecarbonylamino)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]piperidine-1-carboxylate (PubChem CID 26339587) has the molecular formula C23H38N6O3 and a molecular weight of 446.60 g/mol. Its IUPAC name is ethyl 4-[3-[2-(cyclohexanecarbonylamino)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-[2-(cyclohexanecarbonylamino)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 26339587 |
| Molecular Formula | C23H38N6O3 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | ethyl 4-[3-[2-(cyclohexanecarbonylamino)ethyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCc3nnc(CCNC(=O)C4CCCCC4)n3CC2)CC1 |
| InChI | InChI=1S/C23H38N6O3/c1-2-32-23(31)28-13-9-19(10-14-28)27-15-11-21-26-25-20(29(21)17-16-27)8-12-24-22(30)18-6-4-3-5-7-18/h18-19H,2-17H2,1H3,(H,24,30) |
| InChIKey | OIKXTZIXXLQLRT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |