C28H32FN3O3 — CID 26341620
N-[2-(4-fluorophenyl)ethyl]-N-[(7-methoxy-2-morpholin-4-ylquinolin-3-yl)methyl]pent-4-enamide (PubChem CID 26341620) has the molecular formula C28H32FN3O3 and a molecular weight of 477.58 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-N-[(7-methoxy-2-morpholin-4-ylquinolin-3-yl)methyl]pent-4-enamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-N-[(7-methoxy-2-morpholin-4-ylquinolin-3-yl)methyl]pent-4-enamide |
|---|---|
| PubChem CID | 26341620 |
| Molecular Formula | C28H32FN3O3 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-N-[(7-methoxy-2-morpholin-4-ylquinolin-3-yl)methyl]pent-4-enamide |
| SMILES | C=CCCC(=O)N(CCc1ccc(F)cc1)Cc1cc2ccc(OC)cc2nc1N1CCOCC1 |
| InChI | InChI=1S/C28H32FN3O3/c1-3-4-5-27(33)32(13-12-21-6-9-24(29)10-7-21)20-23-18-22-8-11-25(34-2)19-26(22)30-28(23)31-14-16-35-17-15-31/h3,6-11,18-19H,1,4-5,12-17,20H2,2H3 |
| InChIKey | YMRMHVJZJOTNOZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|