C23H33FN2O — CID 26342960
1-[(4aR,8aS)-1-(cyclohexylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-fluorophenyl)ethanone (PubChem CID 26342960) has the molecular formula C23H33FN2O and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-[(4aR,8aS)-1-(cyclohexylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-[(4aR,8aS)-1-(cyclohexylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 26342960 |
| Molecular Formula | C23H33FN2O |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 1-[(4aR,8aS)-1-(cyclohexylmethyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1F)N1CC[C@H]2[C@H](CCCN2CC2CCCCC2)C1 |
| InChI | InChI=1S/C23H33FN2O/c24-21-11-5-4-9-19(21)15-23(27)26-14-12-22-20(17-26)10-6-13-25(22)16-18-7-2-1-3-8-18/h4-5,9,11,18,20,22H,1-3,6-8,10,12-17H2/t20-,22+/m1/s1 |
| InChIKey | MXSOITHKCHXELD-IRLDBZIGSA-N |
| XLogP | 4.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |