About (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine
(4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine (PubChem CID 26344248) has the molecular formula C24H30N4
and a molecular weight of 374.53 g/mol. Its IUPAC name is (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine.
Molecular Properties
| Compound Name | (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine |
| PubChem CID | 26344248 |
| Molecular Formula | C24H30N4 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine |
| SMILES | Cc1ccc2c(C)nc(N3CCC[C@@H](NCCc4ccccc4)CC3)nc2c1 |
| InChI | InChI=1S/C24H30N4/c1-18-10-11-22-19(2)26-24(27-23(22)17-18)28-15-6-9-21(13-16-28)25-14-12-20-7-4-3-5-8-20/h3-5,7-8,10-11,17,21,25H,6,9,12-16H2,1-2H3/t21-/m1/s1 |
| InChIKey | UBXQXNLDPYKKSR-OAQYLSRUSA-N |
| XLogP | 4.44 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine?
The IUPAC name of (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine (CID 26344248) is (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine.
What is the SMILES notation for (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine?
The canonical SMILES for (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine is Cc1ccc2c(C)nc(N3CCC[C@@H](NCCc4ccccc4)CC3)nc2c1.
What is the InChIKey of (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine?
The InChIKey is UBXQXNLDPYKKSR-OAQYLSRUSA-N. The full InChI is InChI=1S/C24H30N4/c1-18-10-11-22-19(2)26-24(27-23(22)17-18)28-15-6-9-21(13-16-28)25-14-12-20-7-4-3-5-8-20/h3-5,7-8,10-11,17,21,25H,6,9,12-16H2,1-2H3/t21-/m1/s1.
What are the key properties of (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine?
(4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine has a molecular weight of 374.53 g/mol, XLogP of 4.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine is sourced from PubChem (CID 26344248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).