C24H30N4 — CID 26344248
(4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine (PubChem CID 26344248) has the molecular formula C24H30N4 and a molecular weight of 374.53 g/mol. Its IUPAC name is (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine.
| Compound Name | (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine |
|---|---|
| PubChem CID | 26344248 |
| Molecular Formula | C24H30N4 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (4R)-1-(4,7-dimethylquinazolin-2-yl)-N-(2-phenylethyl)azepan-4-amine |
| SMILES | Cc1ccc2c(C)nc(N3CCC[C@@H](NCCc4ccccc4)CC3)nc2c1 |
| InChI | InChI=1S/C24H30N4/c1-18-10-11-22-19(2)26-24(27-23(22)17-18)28-15-6-9-21(13-16-28)25-14-12-20-7-4-3-5-8-20/h3-5,7-8,10-11,17,21,25H,6,9,12-16H2,1-2H3/t21-/m1/s1 |
| InChIKey | UBXQXNLDPYKKSR-OAQYLSRUSA-N |
| XLogP | 4.44 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |